* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | Z-GLY-GLY-NH2 |
CAS: | 6422-35-1 |
English Synonyms: | Z-GLY-GLY-NH2 ; Z-GLYCYL-GLYCINE AMIDE |
MDL Number.: | MFCD00047893 |
H bond acceptor: | 7 |
H bond donor: | 3 |
Smile: | c1ccc(cc1)COC(=O)NCC(=O)NCC(=O)N |
InChi: | InChI=1S/C12H15N3O4/c13-10(16)6-14-11(17)7-15-12(18)19-8-9-4-2-1-3-5-9/h1-5H,6-8H2,(H2,13,16)(H,14,17)(H,15,18) |
InChiKey: | InChIKey=DAJXGDMBDLXAAP-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.