* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | O-TOLUIC ANHYDRIDE |
CAS: | 607-86-3 |
English Synonyms: | O-TOLUIC ANHYDRIDE |
MDL Number.: | MFCD00048077 |
H bond acceptor: | 3 |
H bond donor: | 0 |
Smile: | Cc1ccccc1C(=O)OC(=O)c2ccccc2C |
InChi: | InChI=1S/C16H14O3/c1-11-7-3-5-9-13(11)15(17)19-16(18)14-10-6-4-8-12(14)2/h3-10H,1-2H3 |
InChiKey: | InChIKey=YLBSXJWDERHYFY-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.