* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | GERANYL CROTONATE |
| CAS: | 56172-46-4 |
| English Synonyms: | GERANYL CROTONATE |
| MDL Number.: | MFCD00048598 |
| H bond acceptor: | 2 |
| H bond donor: | 0 |
| Smile: | C/C=C/C(=O)OC/C=C(\C)/CCC=C(C)C |
| InChi: | InChI=1S/C14H22O2/c1-5-7-14(15)16-11-10-13(4)9-6-8-12(2)3/h5,7-8,10H,6,9,11H2,1-4H3/b7-5+,13-10+ |
| InChiKey: | InChIKey=MQTAGIYIVBMTBT-XZUSAQEFSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.