* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 7-METHYLXANTHOSINE |
CAS: | 29885-96-9 |
English Synonyms: | 7-METHYLXANTHOSINE |
MDL Number.: | MFCD00049037 |
H bond acceptor: | 10 |
H bond donor: | 5 |
Smile: | CN1CN(c2c1c(=O)[nH]c(=O)[nH]2)[C@H]3[C@@H]([C@@H]([C@H](O3)CO)O)O |
InChi: | InChI=1S/C11H16N4O6/c1-14-3-15(8-5(14)9(19)13-11(20)12-8)10-7(18)6(17)4(2-16)21-10/h4,6-7,10,16-18H,2-3H2,1H3,(H2,12,13,19,20)/t4-,6-,7-,10-/m1/s1 |
InChiKey: | InChIKey=ZWRGMXWESDHQBQ-KQYNXXCUSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.