* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 1,2,3,5-TETRAMETHYLCYCLOHEXANE |
CAS: | 3726-36-1 |
English Synonyms: | 1,2,3,5-TETRAMETHYLCYCLOHEXANE |
MDL Number.: | MFCD00049174 |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | CC1CC(C(C(C1)C)C)C |
InChi: | InChI=1S/C10H20/c1-7-5-8(2)10(4)9(3)6-7/h7-10H,5-6H2,1-4H3 |
InChiKey: | InChIKey=HLPYGMSCWOQRJN-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.