* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 2,6-DIETHYLPYRIDINE |
| CAS: | 1129-30-2 ;935-28-4 |
| English Synonyms: | 2,6-DIETHYLPYRIDINE |
| MDL Number.: | MFCD00049215 |
| H bond acceptor: | 1 |
| H bond donor: | 0 |
| Smile: | CCc1cccc(n1)CC |
| InChi: | InChI=1S/C9H13N/c1-3-8-6-5-7-9(4-2)10-8/h5-7H,3-4H2,1-2H3 |
| InChiKey: | InChIKey=WHTDCOSHHMXZNE-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.