* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RUBIDIUM BROMATE |
English Synonyms: | RUBIDIUM BROMATE |
MDL Number.: | MFCD00050011 |
H bond acceptor: | 3 |
H bond donor: | 0 |
Smile: | [O-]Br(=O)=O.[Rb+] |
InChi: | InChI=1S/BrHO3.Rb/c2-1(3)4;/h(H,2,3,4);/q;+1/p-1 |
InChiKey: | InChIKey=LACSDIAFVPRAER-UHFFFAOYSA-M |
* If the product has intellectual property rights, a license granted is must or contact us.