* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ROSAZURIN B |
English Synonyms: | ROSAZURIN B |
MDL Number.: | MFCD00050063 |
H bond acceptor: | 12 |
H bond donor: | 2 |
Smile: | CCNc1ccc2ccc(cc2c1/N=N/c3ccc(cc3C)c4ccc(c(c4)C)/N=N/c5c(ccc6c5cc(cc6)S(=O)(=O)[O-])NCC)S(=O)(=O)[O-].[Na+].[Na+] |
InChi: | InChI=1S/C38H36N6O6S2.2Na/c1-5-39-35-17-9-25-7-13-29(51(45,46)47)21-31(25)37(35)43-41-33-15-11-27(19-23(33)3)28-12-16-34(24(4)20-28)42-44-38-32-22-30(52(48,49)50)14-8-26(32)10-18-36(38)40-6-2;;/h7-22,39-40H,5-6H2,1-4H3,(H,45,46,47)(H,48,49,50);;/q;2*+1/p-2/b43-41+,44-42+;; |
InChiKey: | InChIKey=XVCXCODNNRPZBL-KNZLDKEQSA-L |
* If the product has intellectual property rights, a license granted is must or contact us.