* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RHODULINE VIOLET |
CAS: | 16508-73-9 |
English Synonyms: | RHODULINE VIOLET |
MDL Number.: | MFCD00050287 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | Cc1cc2c(cc1N)[n+](c3cc(ccc3n2)N(C)C)c4ccccc4.[Cl-] |
InChi: | InChI=1S/C21H20N4.ClH/c1-14-11-19-21(13-17(14)22)25(15-7-5-4-6-8-15)20-12-16(24(2)3)9-10-18(20)23-19;/h4-13,22H,1-3H3;1H |
InChiKey: | InChIKey=IGFPPYWLUIIXOJ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.