* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | H-TRP-ILE-OH |
CAS: | 64339-42-0 |
English Synonyms: | H-TRP-ILE-OH |
MDL Number.: | MFCD00050398 |
H bond acceptor: | 6 |
H bond donor: | 4 |
Smile: | CC[C@H](C)[C@@H](C(=O)O)NC(=O)[C@H](Cc1c[nH]c2c1cccc2)N |
InChi: | InChI=1S/C17H23N3O3/c1-3-10(2)15(17(22)23)20-16(21)13(18)8-11-9-19-14-7-5-4-6-12(11)14/h4-7,9-10,13,15,19H,3,8,18H2,1-2H3,(H,20,21)(H,22,23)/t10-,13-,15-/m0/s1 |
InChiKey: | InChIKey=PITVQFJBUFDJDD-XEGUGMAKSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.