* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | QUININE ACETATE |
CAS: | 18797-86-9 |
English Synonyms: | QUININE ACETATE |
MDL Number.: | MFCD00050910 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | CC(=O)O.COc1ccc2c(c1)c(ccn2)[C@H]([C@@H]3C[C@@H]4CCN3C[C@@H]4C=C)O |
InChi: | InChI=1S/C20H24N2O2.C2H4O2/c1-3-13-12-22-9-7-14(13)10-19(22)20(23)16-6-8-21-18-5-4-15(24-2)11-17(16)18;1-2(3)4/h3-6,8,11,13-14,19-20,23H,1,7,9-10,12H2,2H3;1H3,(H,3,4)/t13-,14-,19-,20+;/m0./s1 |
InChiKey: | InChIKey=LFRDQVMJPQDWTM-DSXUQNDKSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.