* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | INDO OXINE SODIUM SALT |
| English Synonyms: | INDO OXINE SODIUM SALT |
| MDL Number.: | MFCD00050917 |
| H bond acceptor: | 5 |
| H bond donor: | 0 |
| Smile: | c1cc2c(ccc(c2nc1)[O-])/N=C/3\C=CC(=O)c4c3cccn4.[Na+] |
| InChi: | InChI=1S/C18H11N3O2.Na/c22-15-7-5-13(11-3-1-9-19-17(11)15)21-14-6-8-16(23)18-12(14)4-2-10-20-18;/h1-10,22H;/q;+1/p-1/b21-14+; |
| InChiKey: | InChIKey=UABAPJORWUTCCD-UNLLECTCSA-M |
* If the product has intellectual property rights, a license granted is must or contact us.