* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | OTAVA-FLUOR OTVD_0259 |
English Synonyms: | OTAVA-FLUOR OTVD_0259 |
MDL Number.: | MFCD00051251 |
H bond acceptor: | 2 |
H bond donor: | 0 |
Smile: | C/C(=C\c1[n+](c2ccccc2s1)C)/C=C\3/N(c4ccccc4S3)C.[I-] |
InChi: | InChI=1S/C20H19N2S2.HI/c1-14(12-19-21(2)15-8-4-6-10-17(15)23-19)13-20-22(3)16-9-5-7-11-18(16)24-20;/h4-13H,1-3H3;1H/q+1;/p-1 |
InChiKey: | InChIKey=SYAZKCDPODSEIR-UHFFFAOYSA-M |
* If the product has intellectual property rights, a license granted is must or contact us.