* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ZINC ISOVALERATE |
English Synonyms: | ZINC ISOVALERATE |
MDL Number.: | MFCD00053320 |
H bond acceptor: | 4 |
H bond donor: | 0 |
Smile: | CC(C)CC(=O)O[Zn]OC(=O)CC(C)C |
InChi: | InChI=1S/2C5H10O2.Zn/c2*1-4(2)3-5(6)7;/h2*4H,3H2,1-2H3,(H,6,7);/q;;+2/p-2 |
InChiKey: | InChIKey=CHETUOSYZGKTOC-UHFFFAOYSA-L |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.