* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | GUAIENE |
CAS: | 92724-67-9 ;88-84-6 |
English Synonyms: | GUAIENE |
MDL Number.: | MFCD00053474 |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | CC1CCC(=C(C)C)CC2=C1CCC2C |
InChi: | InChI=1S/C15H24/c1-10(2)13-7-5-11(3)14-8-6-12(4)15(14)9-13/h11-12H,5-9H2,1-4H3 |
InChiKey: | InChIKey=GIBQERSGRNPMEH-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.