* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | 1-BROMO-2-METHYLHEPTANE |
CAS: | 72279-59-5 |
English Synonyms: | 1-BROMO-2-METHYLHEPTANE |
MDL Number.: | MFCD00054413 |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | CCCCCC(C)CBr |
InChi: | InChI=1S/C8H17Br/c1-3-4-5-6-8(2)7-9/h8H,3-7H2,1-2H3 |
InChiKey: | InChIKey=FNVAPJKLVSMYCG-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.