* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 7-PROPYL-2,3,6,7-TETRAHYDRO-1H-PURINE-2,6-DIONE |
English Synonyms: | 7-PROPYL-2,3,6,7-TETRAHYDRO-1H-PURINE-2,6-DIONE |
MDL Number.: | MFCD00055082 |
H bond acceptor: | 6 |
H bond donor: | 2 |
Smile: | CCCn1cnc2c1c(=O)[nH]c(=O)[nH]2 |
InChi: | InChI=1S/C8H10N4O2/c1-2-3-12-4-9-6-5(12)7(13)11-8(14)10-6/h4H,2-3H2,1H3,(H2,10,11,13,14) |
InChiKey: | InChIKey=YZYPLLAMOKYMRE-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.