* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | Z-LEU-TYR-NH2 |
| CAS: | 17263-42-2 |
| English Synonyms: | Z-L-LEUCYL-L-TYROSINE AMIDE ; Z-LEU-TYR-NH2 |
| MDL Number.: | MFCD00055743 |
| H bond acceptor: | 8 |
| H bond donor: | 4 |
| Smile: | CC(C)C[C@@H](C(=O)N[C@@H](Cc1ccc(cc1)O)C(=O)N)NC(=O)OCc2ccccc2 |
| InChi: | InChI=1S/C23H29N3O5/c1-15(2)12-20(26-23(30)31-14-17-6-4-3-5-7-17)22(29)25-19(21(24)28)13-16-8-10-18(27)11-9-16/h3-11,15,19-20,27H,12-14H2,1-2H3,(H2,24,28)(H,25,29)(H,26,30)/t19-,20-/m0/s1 |
| InChiKey: | InChIKey=IAYNHAFLVMMCRD-PMACEKPBSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.