* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | GLUTAMIC ACID L [5-14C] |
| CAS: | 24016-48-6 |
| English Synonyms: | GLUTAMIC ACID L [5-14C] |
| MDL Number.: | MFCD00055785 |
| H bond acceptor: | 5 |
| H bond donor: | 3 |
| Smile: | C(C[14C](=O)O)[C@@H](C(=O)O)N |
| InChi: | InChI=1S/C5H9NO4/c6-3(5(9)10)1-2-4(7)8/h3H,1-2,6H2,(H,7,8)(H,9,10)/t3-/m0/s1/i4+2 |
| InChiKey: | InChIKey=WHUUTDBJXJRKMK-QZFAVJRCSA-N |
|
|
|
|
* If the product has intellectual property rights, a license granted is must or contact us.