* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | Z-PHE-BETANA |
| CAS: | 16876-73-6 |
| English Synonyms: | Z-PHE-BETANA |
| MDL Number.: | MFCD00055916 |
| H bond acceptor: | 5 |
| H bond donor: | 2 |
| Smile: | c1ccc(cc1)C[C@@H](C(=O)Nc2ccc3ccccc3c2)NC(=O)OCc4ccccc4 |
| InChi: | InChI=1S/C27H24N2O3/c30-26(28-24-16-15-22-13-7-8-14-23(22)18-24)25(17-20-9-3-1-4-10-20)29-27(31)32-19-21-11-5-2-6-12-21/h1-16,18,25H,17,19H2,(H,28,30)(H,29,31)/t25-/m0/s1 |
| InChiKey: | InChIKey=QQAFIYNIFLTLLZ-VWLOTQADSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.