* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | H-ASP-NH2 |
| CAS: | 28057-52-5 |
| English Synonyms: | H-ISOASN-OH ; L-ISOASPARAGINE ; ASP-NH2 ; H-ASP-NH2 |
| MDL Number.: | MFCD00056118 |
| H bond acceptor: | 5 |
| H bond donor: | 3 |
| Smile: | C([C@@H](C(=O)N)N)C(=O)O |
| InChi: | InChI=1S/C4H8N2O3/c5-2(4(6)9)1-3(7)8/h2H,1,5H2,(H2,6,9)(H,7,8)/t2-/m0/s1 |
| InChiKey: | InChIKey=PMLJIHNCYNOQEQ-REOHCLBHSA-N |
|
|
|
|
* If the product has intellectual property rights, a license granted is must or contact us.