* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | Z-GLY-MET-OH |
CAS: | 3561-48-6 |
English Synonyms: | Z-GLY-MET-OH ; Z-GLYCYL-L-METHIONINE |
MDL Number.: | MFCD00056134 |
H bond acceptor: | 7 |
H bond donor: | 3 |
Smile: | CSCC[C@@H](C(=O)O)NC(=O)CNC(=O)OCc1ccccc1 |
InChi: | InChI=1S/C15H20N2O5S/c1-23-8-7-12(14(19)20)17-13(18)9-16-15(21)22-10-11-5-3-2-4-6-11/h2-6,12H,7-10H2,1H3,(H,16,21)(H,17,18)(H,19,20)/t12-/m0/s1 |
InChiKey: | InChIKey=JXQGLWUIDPXMHD-LBPRGKRZSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.