* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | Z-VAL-PHE-OME |
| CAS: | 4817-95-2 |
| English Synonyms: | Z-VAL-PHE-OME |
| MDL Number.: | MFCD00056140 |
| H bond acceptor: | 7 |
| H bond donor: | 2 |
| Smile: | CC(C)[C@@H](C(=O)N[C@@H](Cc1ccccc1)C(=O)OC)NC(=O)OCc2ccccc2 |
| InChi: | InChI=1S/C23H28N2O5/c1-16(2)20(25-23(28)30-15-18-12-8-5-9-13-18)21(26)24-19(22(27)29-3)14-17-10-6-4-7-11-17/h4-13,16,19-20H,14-15H2,1-3H3,(H,24,26)(H,25,28)/t19-,20-/m0/s1 |
| InChiKey: | InChIKey=LCLXBNDAOUUZSN-PMACEKPBSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.