* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | Z-VAL-ALA-OME |
CAS: | 4817-92-9 |
English Synonyms: | Z-VAL-ALA-OME ; Z-VAL-ALA METHYL ESTER |
MDL Number.: | MFCD00056261 |
H bond acceptor: | 7 |
H bond donor: | 2 |
Smile: | CC(C)[C@@H](C(=O)N[C@@H](C)C(=O)OC)NC(=O)OCc1ccccc1 |
InChi: | InChI=1S/C17H24N2O5/c1-11(2)14(15(20)18-12(3)16(21)23-4)19-17(22)24-10-13-8-6-5-7-9-13/h5-9,11-12,14H,10H2,1-4H3,(H,18,20)(H,19,22)/t12-,14-/m0/s1 |
InChiKey: | InChIKey=VSOOFDMWRZMGLN-JSGCOSHPSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.