* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | IBSCREEN-BB BB_NC-0589 |
English Synonyms: | IBSCREEN-BB BB_NC-0589 |
MDL Number.: | MFCD00056492 |
H bond acceptor: | 3 |
H bond donor: | 0 |
Smile: | C[C@]12CC[C@H]3[C@H]([C@@H]1CC[C@@H]2OC(=O)CCc4ccccc4)CCC5=CC(=O)CCC35 |
InChi: | InChI=1S/C27H34O3/c1-27-16-15-22-21-11-9-20(28)17-19(21)8-10-23(22)24(27)12-13-25(27)30-26(29)14-7-18-5-3-2-4-6-18/h2-6,17,21-25H,7-16H2,1H3/t21?,22-,23-,24+,25+,27+/m1/s1 |
InChiKey: | InChIKey=UBWXUGDQUBIEIZ-DDYORMMTSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.