* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | G-P-R |
| English Synonyms: | GLY-PRO-ARG ; H-GLY-PRO-ARG-OH ; G-P-R |
| MDL Number.: | MFCD00057235 |
| H bond acceptor: | 10 |
| H bond donor: | 6 |
| Smile: | C1C[C@H](N(C1)C(=O)CN)C(=O)N[C@@H](CCCNC(=N)N)C(=O)O |
| InChi: | InChI=1S/C13H24N6O4/c14-7-10(20)19-6-2-4-9(19)11(21)18-8(12(22)23)3-1-5-17-13(15)16/h8-9H,1-7,14H2,(H,18,21)(H,22,23)(H4,15,16,17)/t8-,9-/m0/s1 |
| InChiKey: | InChIKey=JYPCXBJRLBHWME-IUCAKERBSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.