* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | L-PRO-7-AMINO-4-METHYLCOUMARIN |
| English Synonyms: | L-P-AMC ; L-PRO-7-AMINO-4-METHYLCOUMARIN ; L-PRO-AMC |
| MDL Number.: | MFCD00057303 |
| H bond acceptor: | 5 |
| H bond donor: | 2 |
| Smile: | Cc1cc(=O)oc2c1ccc(c2)NC(=O)[C@@H]3CCCN3 |
| InChi: | InChI=1S/C15H16N2O3/c1-9-7-14(18)20-13-8-10(4-5-11(9)13)17-15(19)12-3-2-6-16-12/h4-5,7-8,12,16H,2-3,6H2,1H3,(H,17,19)/t12-/m0/s1 |
| InChiKey: | InChIKey=HSLXTZWJAHQHHF-LBPRGKRZSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.