* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | GLY-ALA-TYR |
CAS: | 92327-84-9 |
English Synonyms: | G-A-Y ; GLY-ALA-TYR ; H-GLY-ALA-TYR-OH |
MDL Number.: | MFCD00057931 |
H bond acceptor: | 8 |
H bond donor: | 5 |
Smile: | C[C@@H](C(=O)N[C@@H](Cc1ccc(cc1)O)C(=O)O)NC(=O)CN |
InChi: | InChI=1S/C14H19N3O5/c1-8(16-12(19)7-15)13(20)17-11(14(21)22)6-9-2-4-10(18)5-3-9/h2-5,8,11,18H,6-7,15H2,1H3,(H,16,19)(H,17,20)(H,21,22)/t8-,11-/m0/s1 |
InChiKey: | InChIKey=QIZJOTQTCAGKPU-KWQFWETISA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.