* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | H-SER-ASN-OH |
CAS: | 81466-41-3 |
English Synonyms: | H-SER-ASN-OH |
MDL Number.: | MFCD00057936 |
H bond acceptor: | 8 |
H bond donor: | 5 |
Smile: | C([C@@H](C(=O)O)NC(=O)[C@H](CO)N)C(=O)N |
InChi: | InChI=1S/C7H13N3O5/c8-3(2-11)6(13)10-4(7(14)15)1-5(9)12/h3-4,11H,1-2,8H2,(H2,9,12)(H,10,13)(H,14,15)/t3-,4-/m0/s1 |
InChiKey: | InChIKey=LTFSLKWFMWZEBD-IMJSIDKUSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.