* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | H-ASP-GLN-OH |
| CAS: | 13433-13-1 |
| English Synonyms: | H-ASP-GLN-OH |
| MDL Number.: | MFCD00057940 |
| H bond acceptor: | 9 |
| H bond donor: | 5 |
| Smile: | C(CC(=O)N)[C@@H](C(=O)O)NC(=O)[C@H](CC(=O)O)N |
| InChi: | InChI=1S/C9H15N3O6/c10-4(3-7(14)15)8(16)12-5(9(17)18)1-2-6(11)13/h4-5H,1-3,10H2,(H2,11,13)(H,12,16)(H,14,15)(H,17,18)/t4-,5-/m0/s1 |
| InChiKey: | InChIKey=GSMPSRPMQQDRIB-WHFBIAKZSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.