* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | H-VAL-LEU-LYS-PNA 2HCL |
CAS: | 201807-16-1 |
English Synonyms: | H-VAL-LEU-LYS-PNA 2HCL |
MDL Number.: | MFCD00058246 |
H bond acceptor: | 11 |
H bond donor: | 5 |
Smile: | CC(C)C[C@@H](C(=O)N[C@@H](CCCCN)C(=O)Nc1ccc(cc1)[N+](=O)[O-])NC(=O)[C@H](C(C)C)N.Cl.Cl |
InChi: | InChI=1S/C23H38N6O5.2ClH/c1-14(2)13-19(28-23(32)20(25)15(3)4)22(31)27-18(7-5-6-12-24)21(30)26-16-8-10-17(11-9-16)29(33)34;;/h8-11,14-15,18-20H,5-7,12-13,24-25H2,1-4H3,(H,26,30)(H,27,31)(H,28,32);2*1H/t18-,19-,20-;;/m0../s1 |
InChiKey: | InChIKey=VESQMNNSPPEOSZ-JADADVEQSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.