* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | H-VAL-LYS-OH HCL |
English Synonyms: | H-VAL-LYS-OH HCL |
MDL Number.: | MFCD00058266 |
H bond acceptor: | 6 |
H bond donor: | 4 |
Smile: | CC(C)[C@@H](C(=O)N[C@@H](CCCCN)C(=O)O)N.Cl |
InChi: | InChI=1S/C11H23N3O3.ClH/c1-7(2)9(13)10(15)14-8(11(16)17)5-3-4-6-12;/h7-9H,3-6,12-13H2,1-2H3,(H,14,15)(H,16,17);1H/t8-,9-;/m0./s1 |
InChiKey: | InChIKey=RRCWWDVGBCHDOR-OZZZDHQUSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.