* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | H-PRO-ASN-OH |
CAS: | 107856-82-6 |
English Synonyms: | H-PRO-ASN-OH ; PRO-ASN |
MDL Number.: | MFCD00058560 |
H bond acceptor: | 7 |
H bond donor: | 4 |
Smile: | C1C[C@H](NC1)C(=O)N[C@@H](CC(=O)N)C(=O)O |
InChi: | InChI=1S/C9H15N3O4/c10-7(13)4-6(9(15)16)12-8(14)5-2-1-3-11-5/h5-6,11H,1-4H2,(H2,10,13)(H,12,14)(H,15,16)/t5-,6-/m0/s1 |
InChiKey: | InChIKey=JQOHKCDMINQZRV-WDSKDSINSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.