* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | Z-ALA-PRO-TYR-OH |
CAS: | 112898-29-0 |
English Synonyms: | Z-ALA-PRO-TYR-OH |
MDL Number.: | MFCD00058568 |
H bond acceptor: | 10 |
H bond donor: | 4 |
Smile: | C[C@@H](C(=O)N1CCC[C@H]1C(=O)N[C@@H](Cc2ccc(cc2)O)C(=O)O)NC(=O)OCc3ccccc3 |
InChi: | InChI=1S/C25H29N3O7/c1-16(26-25(34)35-15-18-6-3-2-4-7-18)23(31)28-13-5-8-21(28)22(30)27-20(24(32)33)14-17-9-11-19(29)12-10-17/h2-4,6-7,9-12,16,20-21,29H,5,8,13-15H2,1H3,(H,26,34)(H,27,30)(H,32,33)/t16-,20-,21-/m0/s1 |
InChiKey: | InChIKey=BZZSGOXWDYSEQB-NDXORKPFSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.