* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | O-TOLIDINE SULFATE |
| English Synonyms: | O-TOLIDINE SULFATE |
| MDL Number.: | MFCD00060257 |
| H bond acceptor: | 2 |
| H bond donor: | 2 |
| Smile: | Cc1cc(ccc1N)c2ccc(c(c2)C)N.Cc1cc(ccc1N)c2ccc(c(c2)C)N.OS(=O)(=O)O |
| InChi: | InChI=1S/2C14H16N2.H2O4S/c2*1-9-7-11(3-5-13(9)15)12-4-6-14(16)10(2)8-12;1-5(2,3)4/h2*3-8H,15-16H2,1-2H3;(H2,1,2,3,4) |
| InChiKey: | InChIKey=YIWOIXQJLPSHKX-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.