* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 2-METHYL-1-HEPTANOL |
| CAS: | 60435-70-3 |
| English Synonyms: | 2-METHYLHEPTAN-1-OL ; 2-METHYL-1-HEPTANOL |
| MDL Number.: | MFCD00060901 |
| H bond acceptor: | 1 |
| H bond donor: | 1 |
| Smile: | CCCCCC(C)CO |
| InChi: | InChI=1S/C8H18O/c1-3-4-5-6-8(2)7-9/h8-9H,3-7H2,1-2H3 |
| InChiKey: | InChIKey=QZESEQBMSFFHRY-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.