* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | IBSCREEN-BB BB_NC-2321 |
English Synonyms: | IBSCREEN-BB BB_NC-2321 |
MDL Number.: | MFCD00062962 |
H bond acceptor: | 1 |
H bond donor: | 1 |
Smile: | CC(C)c1ccc2c(c1)CCC3C2(CCCC3(C)CN)C |
InChi: | InChI=1S/C20H31N/c1-14(2)15-6-8-17-16(12-15)7-9-18-19(3,13-21)10-5-11-20(17,18)4/h6,8,12,14,18H,5,7,9-11,13,21H2,1-4H3 |
InChiKey: | InChIKey=JVVXZOOGOGPDRZ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.