* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | LABOTEST-BB LT00454545 |
| English Synonyms: | LABOTEST-BB LT00454545 |
| MDL Number.: | MFCD00063190 |
| H bond acceptor: | 6 |
| H bond donor: | 3 |
| Smile: | CC(C)(CO)[C@H](C(=O)NCCC(=O)[O-])O.[Na+] |
| InChi: | InChI=1S/C9H17NO5.Na/c1-9(2,5-11)7(14)8(15)10-4-3-6(12)13;/h7,11,14H,3-5H2,1-2H3,(H,10,15)(H,12,13);/q;+1/p-1/t7-;/m0./s1 |
| InChiKey: | InChIKey=GQTHJBOWLPZUOI-FJXQXJEOSA-M |
* If the product has intellectual property rights, a license granted is must or contact us.