* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | Z-PRO-LEU-OH |
CAS: | 1634-90-8 |
English Synonyms: | Z-PRO-LEU-OH ; Z-L-PROLYL-L-LEUCINE |
MDL Number.: | MFCD00063227 |
H bond acceptor: | 7 |
H bond donor: | 2 |
Smile: | CC(C)C[C@@H](C(=O)O)NC(=O)[C@@H]1CCCN1C(=O)OCc2ccccc2 |
InChi: | InChI=1S/C19H26N2O5/c1-13(2)11-15(18(23)24)20-17(22)16-9-6-10-21(16)19(25)26-12-14-7-4-3-5-8-14/h3-5,7-8,13,15-16H,6,9-12H2,1-2H3,(H,20,22)(H,23,24)/t15-,16-/m0/s1 |
InChiKey: | InChIKey=YCYXUKRYYSXSLJ-HOTGVXAUSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.