* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RHODAMINE B AMINE |
English Synonyms: | RHODAMINE B AMINE |
MDL Number.: | MFCD00063515 |
H bond acceptor: | 6 |
H bond donor: | 2 |
Smile: | CCN(CC)c1ccc2c(c1)oc-3cc(=[N+](CC)CC)ccc3c2c4ccc(cc4C(=O)O)N.[Cl-] |
InChi: | InChI=1S/C28H31N3O3.ClH/c1-5-30(6-2)19-10-13-22-25(16-19)34-26-17-20(31(7-3)8-4)11-14-23(26)27(22)21-12-9-18(29)15-24(21)28(32)33;/h9-17,29H,5-8H2,1-4H3,(H,32,33);1H |
InChiKey: | InChIKey=KHPKXARDVYLOSQ-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.