* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 9(S)-HETE |
CAS: | 79495-85-5 ;107656-13-3 |
English Synonyms: | 9(S)-HYDROXY-(5Z,7E,11Z,14Z)-EICOSATETRAENOIC ACID ; 9(S)-HETE |
MDL Number.: | MFCD00063582 |
H bond acceptor: | 3 |
H bond donor: | 2 |
Smile: | CCCCC/C=C\C/C=C\C[C@@H](/C=C/C=C\CCCC(=O)O)O |
InChi: | InChI=1S/C20H32O3/c1-2-3-4-5-6-7-8-10-13-16-19(21)17-14-11-9-12-15-18-20(22)23/h6-7,9-11,13-14,17,19,21H,2-5,8,12,15-16,18H2,1H3,(H,22,23)/b7-6-,11-9-,13-10-,17-14+/t19-/m0/s1 |
InChiKey: | InChIKey=KATOYYZUTNAWSA-VBLHFSPLSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.