* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ZERENEX ZX-CF000617 |
| English Synonyms: | ZERENEX ZX-CF000617 |
| MDL Number.: | MFCD00063622 |
| H bond acceptor: | 2 |
| H bond donor: | 1 |
| Smile: | C[C@]12CC[C@H]3[C@H]([C@@H]1CCC2=O)CC=C4[C@@]3(CC[C@@H](C4)O)C |
| InChi: | InChI=1S/C19H28O2/c1-18-9-7-13(20)11-12(18)3-4-14-15-5-6-17(21)19(15,2)10-8-16(14)18/h3,13-16,20H,4-11H2,1-2H3/t13-,14-,15-,16-,18-,19-/m0/s1 |
| InChiKey: | InChIKey=FMGSKLZLMKYGDP-USOAJAOKSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.