* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | LABOTEST-BB LT03333305 |
| English Synonyms: | LABOTEST-BB LT03333305 |
| MDL Number.: | MFCD00063632 |
| H bond acceptor: | 4 |
| H bond donor: | 2 |
| Smile: | C1CC/C(=N/O)/C(=N/O)/C1 |
| InChi: | InChI=1S/C6H10N2O2/c9-7-5-3-1-2-4-6(5)8-10/h9-10H,1-4H2/b7-5-,8-6+ |
| InChiKey: | InChIKey=CUNNCKOPAWXYDX-CGXWXWIYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.