* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | LABOTEST-BB LT00440843 |
| English Synonyms: | LABOTEST-BB LT00440843 |
| MDL Number.: | MFCD00063637 |
| H bond acceptor: | 3 |
| H bond donor: | 2 |
| Smile: | C1[C@@H](NCS1)C(=O)O |
| InChi: | InChI=1S/C4H7NO2S/c6-4(7)3-1-8-2-5-3/h3,5H,1-2H2,(H,6,7)/t3-/m1/s1 |
| InChiKey: | InChIKey=DZLNHFMRPBPULJ-GSVOUGTGSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.