* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | LABOTEST-BB LT00455070 |
| English Synonyms: | LABOTEST-BB LT00455070 |
| MDL Number.: | MFCD00063661 |
| H bond acceptor: | 4 |
| H bond donor: | 2 |
| Smile: | CC(=O)N[C@H](CS)C(=O)O |
| InChi: | InChI=1S/C5H9NO3S/c1-3(7)6-4(2-10)5(8)9/h4,10H,2H2,1H3,(H,6,7)(H,8,9)/t4-/m1/s1 |
| InChiKey: | InChIKey=PWKSKIMOESPYIA-SCSAIBSYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.