* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | LABOTEST-BB LT00848063 |
| English Synonyms: | LABOTEST-BB LT00848063 |
| MDL Number.: | MFCD00063738 |
| H bond acceptor: | 8 |
| H bond donor: | 4 |
| Smile: | c1cn(c(=O)[nH]c1=O)[C@H]2[C@@H]([C@@H]([C@H](O2)CO)O)O |
| InChi: | InChI=1S/C9H12N2O6/c12-3-4-6(14)7(15)8(17-4)11-2-1-5(13)10-9(11)16/h1-2,4,6-8,12,14-15H,3H2,(H,10,13,16)/t4-,6-,7-,8-/m1/s1 |
| InChiKey: | InChIKey=DRTQHJPVMGBUCF-XVFCMESISA-N |
* If the product has intellectual property rights, a license granted is must or contact us.