* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | LABOTEST-BB LT00440761 |
| English Synonyms: | LABOTEST-BB LT00440761 |
| MDL Number.: | MFCD00063837 |
| H bond acceptor: | 7 |
| H bond donor: | 3 |
| Smile: | c1ccc(cc1)COC(=O)N[C@@H](CC(=O)N)C(=O)O |
| InChi: | InChI=1S/C12H14N2O5/c13-10(15)6-9(11(16)17)14-12(18)19-7-8-4-2-1-3-5-8/h1-5,9H,6-7H2,(H2,13,15)(H,14,18)(H,16,17)/t9-/m0/s1 |
| InChiKey: | InChIKey=FUCKRCGERFLLHP-VIFPVBQESA-N |
* If the product has intellectual property rights, a license granted is must or contact us.