* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | L-S-BENZYLCYSTEINE |
| English Synonyms: | L-S-BENZYLCYSTEINE |
| MDL Number.: | MFCD00063875 |
| H bond acceptor: | 3 |
| H bond donor: | 2 |
| Smile: | c1ccc(cc1)CSC[C@H](C(=O)O)N |
| InChi: | InChI=1S/C10H13NO2S/c11-9(10(12)13)7-14-6-8-4-2-1-3-5-8/h1-5,9H,6-7,11H2,(H,12,13)/t9-/m1/s1 |
| InChiKey: | InChIKey=GHBAYRBVXCRIHT-SECBINFHSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.