* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | LABOTEST-BB LT00772045 |
| English Synonyms: | LABOTEST-BB LT00772045 |
| MDL Number.: | MFCD00063878 |
| H bond acceptor: | 9 |
| H bond donor: | 2 |
| Smile: | CC1(O[C@@H]2[C@H](O[C@H]([C@@H]2O1)n3cnc4c3ncnc4N)CO)C |
| InChi: | InChI=1S/C13H17N5O4/c1-13(2)21-8-6(3-19)20-12(9(8)22-13)18-5-17-7-10(14)15-4-16-11(7)18/h4-6,8-9,12,19H,3H2,1-2H3,(H2,14,15,16)/t6-,8-,9-,12-/m1/s1 |
| InChiKey: | InChIKey=LCCLUOXEZAHUNS-WOUKDFQISA-N |
* If the product has intellectual property rights, a license granted is must or contact us.