* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | LABOTEST-BB LT00455679 |
| English Synonyms: | LABOTEST-BB LT00455679 |
| MDL Number.: | MFCD00063894 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | CO[C@H](c1ccccc1)C(=O)O |
| InChi: | InChI=1S/C9H10O3/c1-12-8(9(10)11)7-5-3-2-4-6-7/h2-6,8H,1H3,(H,10,11)/t8-/m1/s1 |
| InChiKey: | InChIKey=DIWVBIXQCNRCFE-MRVPVSSYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.